C22H27NO3 — CID 91303339
(3S,5S,6S,7S,11S,18R)-6-hydroxy-6-(hydroxymethyl)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,16-diene-18-carbonitrile (PubChem CID 91303339) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3S,5S,6S,7S,11S,18R)-6-hydroxy-6-(hydroxymethyl)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,16-diene-18-carbonitrile.
| Compound Name | (3S,5S,6S,7S,11S,18R)-6-hydroxy-6-(hydroxymethyl)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,16-diene-18-carbonitrile |
|---|---|
| PubChem CID | 91303339 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3S,5S,6S,7S,11S,18R)-6-hydroxy-6-(hydroxymethyl)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,16-diene-18-carbonitrile |
| SMILES | C[C@]12CCC(=O)CC1=C[C@@H](C#N)C1C2=CC[C@@]2(C)C1C1C[C@@H]1[C@@]2(O)CO |
| InChI | InChI=1S/C22H27NO3/c1-20-5-3-14(25)8-13(20)7-12(10-23)18-16(20)4-6-21(2)19(18)15-9-17(15)22(21,26)11-24/h4,7,12,15,17-19,24,26H,3,5-6,8-9,11H2,1-2H3/t12-,15?,17-,18?,19?,20-,21-,22-/m0/s1 |
| InChIKey | ZBOJALIZGHWDRY-UMIPBFMXSA-N |
| XLogP | 2.77 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|