C26H35NO4 — CID 58834269
(3'S,4S,5'S,7'S,11'S,18'R)-18'-[(E)-methoxyiminomethyl]-2,2,7',11'-tetramethylspiro[1,3-dioxolane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-diene]-14'-one (PubChem CID 58834269) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3'S,4S,5'S,7'S,11'S,18'R)-18'-[(E)-methoxyiminomethyl]-2,2,7',11'-tetramethylspiro[1,3-dioxolane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-diene]-14'-one.
| Compound Name | (3'S,4S,5'S,7'S,11'S,18'R)-18'-[(E)-methoxyiminomethyl]-2,2,7',11'-tetramethylspiro[1,3-dioxolane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-diene]-14'-one |
|---|---|
| PubChem CID | 58834269 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (3'S,4S,5'S,7'S,11'S,18'R)-18'-[(E)-methoxyiminomethyl]-2,2,7',11'-tetramethylspiro[1,3-dioxolane-4,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-diene]-14'-one |
| SMILES | CO/N=C/[C@@H]1CC2=CC(=O)CC[C@]2(C)C2=CC[C@@]3(C)C(C21)C1C[C@@H]1[C@@]31COC(C)(C)O1 |
| InChI | InChI=1S/C26H35NO4/c1-23(2)30-14-26(31-23)20-12-18(20)22-21-15(13-27-29-5)10-16-11-17(28)6-8-24(16,3)19(21)7-9-25(22,26)4/h7,11,13,15,18,20-22H,6,8-10,12,14H2,1-5H3/b27-13+/t15-,18?,20-,21?,22?,24-,25-,26-/m0/s1 |
| InChIKey | OKAOYWMKZVZPGQ-ZYAVBEBJSA-N |
| XLogP | 4.67 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|