C11H11F3N2O — CID 91306652
4-methyl-1-[4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]imidazole (PubChem CID 91306652) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 4-methyl-1-[4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]imidazole.
| Compound Name | 4-methyl-1-[4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]imidazole |
|---|---|
| PubChem CID | 91306652 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-methyl-1-[4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]imidazole |
| SMILES | C=CC(OC(F)(F)F)=C(C=C)n1cnc(C)c1 |
| InChI | InChI=1S/C11H11F3N2O/c1-4-9(16-6-8(3)15-7-16)10(5-2)17-11(12,13)14/h4-7H,1-2H2,3H3 |
| InChIKey | JJZFDDXCXDJVOM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|