C24H39NO5 — CID 91309806
(2S,3R,4S,6R)-3-[(4R,5S,6S)-4-methoxy-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxy-N,N,2,6-tetramethyloxan-4-amine (PubChem CID 91309806) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is (2S,3R,4S,6R)-3-[(4R,5S,6S)-4-methoxy-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxy-N,N,2,6-tetramethyloxan-4-amine.
| Compound Name | (2S,3R,4S,6R)-3-[(4R,5S,6S)-4-methoxy-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxy-N,N,2,6-tetramethyloxan-4-amine |
|---|---|
| PubChem CID | 91309806 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (2S,3R,4S,6R)-3-[(4R,5S,6S)-4-methoxy-4,6-dimethyl-5-phenylmethoxyoxan-2-yl]oxy-N,N,2,6-tetramethyloxan-4-amine |
| SMILES | CO[C@]1(C)CC(O[C@H]2[C@H](C)O[C@H](C)C[C@@H]2N(C)C)O[C@@H](C)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H39NO5/c1-16-13-20(25(5)6)22(17(2)28-16)30-21-14-24(4,26-7)23(18(3)29-21)27-15-19-11-9-8-10-12-19/h8-12,16-18,20-23H,13-15H2,1-7H3/t16-,17+,18+,20+,21?,22+,23+,24-/m1/s1 |
| InChIKey | ZMFRHLOQXYDEAY-NZQBIEKVSA-N |
| XLogP | 3.62 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |