C20H18ClNO6 — CID 91314509
[5-chloro-3-hydroxy-3-(6-hydroxy-2,3-dihydro-1-benzofuran-5-yl)-2H-indol-1-yl] 2-oxobutanoate (PubChem CID 91314509) has the molecular formula C20H18ClNO6 and a molecular weight of 403.82 g/mol. Its IUPAC name is [5-chloro-3-hydroxy-3-(6-hydroxy-2,3-dihydro-1-benzofuran-5-yl)-2H-indol-1-yl] 2-oxobutanoate.
| Compound Name | [5-chloro-3-hydroxy-3-(6-hydroxy-2,3-dihydro-1-benzofuran-5-yl)-2H-indol-1-yl] 2-oxobutanoate |
|---|---|
| PubChem CID | 91314509 |
| Molecular Formula | C20H18ClNO6 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [5-chloro-3-hydroxy-3-(6-hydroxy-2,3-dihydro-1-benzofuran-5-yl)-2H-indol-1-yl] 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)ON1CC(O)(c2cc3c(cc2O)OCC3)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H18ClNO6/c1-2-16(23)19(25)28-22-10-20(26,13-8-12(21)3-4-15(13)22)14-7-11-5-6-27-18(11)9-17(14)24/h3-4,7-9,24,26H,2,5-6,10H2,1H3 |
| InChIKey | NHOCWEMYCHIRCW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|