C10H20N4O2 — CID 91320946
2-amino-4-butan-2-yl-1,3,6-triazaspiro[4.4]non-2-ene-9,9-diol (PubChem CID 91320946) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-amino-4-butan-2-yl-1,3,6-triazaspiro[4.4]non-2-ene-9,9-diol.
| Compound Name | 2-amino-4-butan-2-yl-1,3,6-triazaspiro[4.4]non-2-ene-9,9-diol |
|---|---|
| PubChem CID | 91320946 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-amino-4-butan-2-yl-1,3,6-triazaspiro[4.4]non-2-ene-9,9-diol |
| SMILES | CCC(C)C1N=C(N)NC12NCCC2(O)O |
| InChI | InChI=1S/C10H20N4O2/c1-3-6(2)7-10(14-8(11)13-7)9(15,16)4-5-12-10/h6-7,12,15-16H,3-5H2,1-2H3,(H3,11,13,14) |
| InChIKey | AIABVHDPVZDALV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|