C14H20N2O — CID 91322797
1-(8-methoxy-6-methylocta-1,4,6-trien-3-yl)-4-methylimidazole (PubChem CID 91322797) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(8-methoxy-6-methylocta-1,4,6-trien-3-yl)-4-methylimidazole.
| Compound Name | 1-(8-methoxy-6-methylocta-1,4,6-trien-3-yl)-4-methylimidazole |
|---|---|
| PubChem CID | 91322797 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(8-methoxy-6-methylocta-1,4,6-trien-3-yl)-4-methylimidazole |
| SMILES | C=CC(C=CC(C)=CCOC)n1cnc(C)c1 |
| InChI | InChI=1S/C14H20N2O/c1-5-14(16-10-13(3)15-11-16)7-6-12(2)8-9-17-4/h5-8,10-11,14H,1,9H2,2-4H3 |
| InChIKey | RXWDJUTYEYMZAT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|