C51H43N4O4+ — CID 91329325
5-[N-ethyl-4-[5-[2-[ethyl-(2-methyl-1,3-dioxoisoindol-5-yl)amino]phenyl]-1,5-diphenylpenta-1,3-dienyl]anilino]-2-methylisoindole-1,3-dione (PubChem CID 91329325) has the molecular formula C51H43N4O4+ and a molecular weight of 775.93 g/mol. Its IUPAC name is 5-[N-ethyl-4-[5-[2-[ethyl-(2-methyl-1,3-dioxoisoindol-5-yl)amino]phenyl]-1,5-diphenylpenta-1,3-dienyl]anilino]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[N-ethyl-4-[5-[2-[ethyl-(2-methyl-1,3-dioxoisoindol-5-yl)amino]phenyl]-1,5-diphenylpenta-1,3-dienyl]anilino]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 91329325 |
| Molecular Formula | C51H43N4O4+ |
| Molecular Weight | 775.93 g/mol |
| Exact Mass | 775.33 |
| IUPAC Name | 5-[N-ethyl-4-[5-[2-[ethyl-(2-methyl-1,3-dioxoisoindol-5-yl)amino]phenyl]-1,5-diphenylpenta-1,3-dienyl]anilino]-2-methylisoindole-1,3-dione |
| SMILES | CCN(c1ccc(C(=CC=C[C+](c2ccccc2)c2ccccc2N(CC)c2ccc3c(c2)C(=O)N(C)C3=O)c2ccccc2)cc1)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C51H43N4O4/c1-5-54(38-28-30-43-45(32-38)50(58)52(3)48(43)56)37-26-24-36(25-27-37)40(34-16-9-7-10-17-34)21-15-22-41(35-18-11-8-12-19-35)42-20-13-14-23-47(42)55(6-2)39-29-31-44-46(33-39)51(59)53(4)49(44)57/h7-33H,5-6H2,1-4H3/q+1 |
| InChIKey | PZZOBMGDPZWAKA-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.93 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|