C19H40 — CID 91329913
3-ethyl-2,2,7-trimethyl-4,5-di(propan-2-yl)octane (PubChem CID 91329913) has the molecular formula C19H40 and a molecular weight of 268.53 g/mol. Its IUPAC name is 3-ethyl-2,2,7-trimethyl-4,5-di(propan-2-yl)octane.
| Compound Name | 3-ethyl-2,2,7-trimethyl-4,5-di(propan-2-yl)octane |
|---|---|
| PubChem CID | 91329913 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 3-ethyl-2,2,7-trimethyl-4,5-di(propan-2-yl)octane |
| SMILES | CCC(C(C(C)C)C(CC(C)C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H40/c1-11-17(19(8,9)10)18(15(6)7)16(14(4)5)12-13(2)3/h13-18H,11-12H2,1-10H3 |
| InChIKey | OYOYLSHOPUGTFB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |