C12H18FN2O+ — CID 9133208
(2-amino-2-oxoethyl)-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133208) has the molecular formula C12H18FN2O+ and a molecular weight of 225.29 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | (2-amino-2-oxoethyl)-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133208 |
| Molecular Formula | C12H18FN2O+ |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (2-amino-2-oxoethyl)-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FN2O/c1-8(2)12(15-7-11(14)16)9-3-5-10(13)6-4-9/h3-6,8,12,15H,7H2,1-2H3,(H2,14,16)/p+1/t12-/m1/s1 |
| InChIKey | ZCTKQKULYBSQIO-GFCCVEGCSA-O |
| XLogP | 0.57 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |