C22H23NO6S2 — CID 91333226
N-[3-(3-ethoxy-3-hydroxypropyl)sulfanyl-4-oxonaphthalen-1-ylidene]-1-(4-hydroxyphenyl)methanesulfonamide (PubChem CID 91333226) has the molecular formula C22H23NO6S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-[3-(3-ethoxy-3-hydroxypropyl)sulfanyl-4-oxonaphthalen-1-ylidene]-1-(4-hydroxyphenyl)methanesulfonamide.
| Compound Name | N-[3-(3-ethoxy-3-hydroxypropyl)sulfanyl-4-oxonaphthalen-1-ylidene]-1-(4-hydroxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 91333226 |
| Molecular Formula | C22H23NO6S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[3-(3-ethoxy-3-hydroxypropyl)sulfanyl-4-oxonaphthalen-1-ylidene]-1-(4-hydroxyphenyl)methanesulfonamide |
| SMILES | CCOC(O)CCSC1=CC(=NS(=O)(=O)Cc2ccc(O)cc2)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23NO6S2/c1-2-29-21(25)11-12-30-20-13-19(17-5-3-4-6-18(17)22(20)26)23-31(27,28)14-15-7-9-16(24)10-8-15/h3-10,13,21,24-25H,2,11-12,14H2,1H3 |
| InChIKey | UNRLWTMFZSHRBY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|