C10H24N4O — CID 91339588
2,4-diamino-N-[3-(dimethylamino)butyl]butanamide (PubChem CID 91339588) has the molecular formula C10H24N4O and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,4-diamino-N-[3-(dimethylamino)butyl]butanamide.
| Compound Name | 2,4-diamino-N-[3-(dimethylamino)butyl]butanamide |
|---|---|
| PubChem CID | 91339588 |
| Molecular Formula | C10H24N4O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 2,4-diamino-N-[3-(dimethylamino)butyl]butanamide |
| SMILES | CC(CCNC(=O)C(N)CCN)N(C)C |
| InChI | InChI=1S/C10H24N4O/c1-8(14(2)3)5-7-13-10(15)9(12)4-6-11/h8-9H,4-7,11-12H2,1-3H3,(H,13,15) |
| InChIKey | HWGIJCAWVFOKNK-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |