C20H22ClN4O4+ — CID 9134349
1-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9134349) has the molecular formula C20H22ClN4O4+ and a molecular weight of 417.87 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9134349 |
| Molecular Formula | C20H22ClN4O4+ |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | O=C(C[NH+]1CCC(C(=O)Nc2ccccc2)CC1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H21ClN4O4/c21-17-12-16(25(28)29)6-7-18(17)23-19(26)13-24-10-8-14(9-11-24)20(27)22-15-4-2-1-3-5-15/h1-7,12,14H,8-11,13H2,(H,22,27)(H,23,26)/p+1 |
| InChIKey | GILLIKVIHJHNTA-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|