C14H23F2N — CID 91344076
N-(4,4-difluorocyclohexyl)-4-ethylhex-3-en-2-imine (PubChem CID 91344076) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-4-ethylhex-3-en-2-imine.
| Compound Name | N-(4,4-difluorocyclohexyl)-4-ethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 91344076 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-4-ethylhex-3-en-2-imine |
| SMILES | CCC(=C/C(C)=N/C1CCC(F)(F)CC1)CC |
| InChI | InChI=1S/C14H23F2N/c1-4-12(5-2)10-11(3)17-13-6-8-14(15,16)9-7-13/h10,13H,4-9H2,1-3H3/b17-11+ |
| InChIKey | SZNNZUJHBALNSQ-GZTJUZNOSA-N |
| XLogP | 4.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|