C27H46N2O5 — CID 91347732
2,2-dimethylbutane-1,1-diol;N-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,2-dimethylbutanamide;2-methylbutanenitrile (PubChem CID 91347732) has the molecular formula C27H46N2O5 and a molecular weight of 478.67 g/mol. Its IUPAC name is 2,2-dimethylbutane-1,1-diol;N-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,2-dimethylbutanamide;2-methylbutanenitrile.
| Compound Name | 2,2-dimethylbutane-1,1-diol;N-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,2-dimethylbutanamide;2-methylbutanenitrile |
|---|---|
| PubChem CID | 91347732 |
| Molecular Formula | C27H46N2O5 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | 2,2-dimethylbutane-1,1-diol;N-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]-2,2-dimethylbutanamide;2-methylbutanenitrile |
| SMILES | C=C(C)C(O)Oc1ccc(NC(=O)C(C)(C)CC)cc1.CCC(C)(C)C(O)O.CCC(C)C#N |
| InChI | InChI=1S/C16H23NO3.C6H14O2.C5H9N/c1-6-16(4,5)15(19)17-12-7-9-13(10-8-12)20-14(18)11(2)3;1-4-6(2,3)5(7)8;1-3-5(2)4-6/h7-10,14,18H,2,6H2,1,3-5H3,(H,17,19);5,7-8H,4H2,1-3H3;5H,3H2,1-2H3 |
| InChIKey | PULKXMPLVOWJNX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|