C23H43NO6 — CID 91307682
2,2-dimethylbutane-1,1-diol;2-methylbutanenitrile;2-(2-methylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate (PubChem CID 91307682) has the molecular formula C23H43NO6 and a molecular weight of 429.60 g/mol. Its IUPAC name is 2,2-dimethylbutane-1,1-diol;2-methylbutanenitrile;2-(2-methylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2,2-dimethylbutane-1,1-diol;2-methylbutanenitrile;2-(2-methylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91307682 |
| Molecular Formula | C23H43NO6 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | 2,2-dimethylbutane-1,1-diol;2-methylbutanenitrile;2-(2-methylprop-2-enoyloxy)ethyl 2,2-dimethylbutanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(C)(C)CC.CCC(C)(C)C(O)O.CCC(C)C#N |
| InChI | InChI=1S/C12H20O4.C6H14O2.C5H9N/c1-6-12(4,5)11(14)16-8-7-15-10(13)9(2)3;1-4-6(2,3)5(7)8;1-3-5(2)4-6/h2,6-8H2,1,3-5H3;5,7-8H,4H2,1-3H3;5H,3H2,1-2H3 |
| InChIKey | QGYVJTSLCBOKHS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|