C23H30FN2+ — CID 91356022
12-butyl-2,3-diethyl-5-fluoro-2,3-dimethyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),9,12-hexaene (PubChem CID 91356022) has the molecular formula C23H30FN2+ and a molecular weight of 353.51 g/mol. Its IUPAC name is 12-butyl-2,3-diethyl-5-fluoro-2,3-dimethyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),9,12-hexaene.
| Compound Name | 12-butyl-2,3-diethyl-5-fluoro-2,3-dimethyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),9,12-hexaene |
|---|---|
| PubChem CID | 91356022 |
| Molecular Formula | C23H30FN2+ |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 12-butyl-2,3-diethyl-5-fluoro-2,3-dimethyl-11-aza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),9,12-hexaene |
| SMILES | CCCCc1c[n+]2c3c4c(c(F)ccc4ccn13)C(C)(CC)C2(C)CC |
| InChI | InChI=1S/C23H30FN2/c1-6-9-10-17-15-26-21-19-16(13-14-25(17)21)11-12-18(24)20(19)22(4,7-2)23(26,5)8-3/h11-15H,6-10H2,1-5H3/q+1 |
| InChIKey | IUGWSJIKGAFLQN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|