C30H30Cl2N2O4 — CID 91361817
(4-chlorophenyl) 6-chloro-1-[6-methyl-4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91361817) has the molecular formula C30H30Cl2N2O4 and a molecular weight of 553.49 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[6-methyl-4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[6-methyl-4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91361817 |
| Molecular Formula | C30H30Cl2N2O4 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[6-methyl-4-(oxan-4-yloxy)cyclohexa-2,4-dien-1-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC1C=C(OC2CCOCC2)C=CC1C1c2[nH]c3ccc(Cl)cc3c2CCN1C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H30Cl2N2O4/c1-18-16-23(37-22-11-14-36-15-12-22)7-8-24(18)29-28-25(26-17-20(32)4-9-27(26)33-28)10-13-34(29)30(35)38-21-5-2-19(31)3-6-21/h2-9,16-18,22,24,29,33H,10-15H2,1H3 |
| InChIKey | KGQISBMJDITINY-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|