C25H25N3O6 — CID 91365148
(2,5-dihydroxypyrrol-1-yl) 6-(2-acetamido-9-oxoacridin-10-yl)hexanoate (PubChem CID 91365148) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-(2-acetamido-9-oxoacridin-10-yl)hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-(2-acetamido-9-oxoacridin-10-yl)hexanoate |
|---|---|
| PubChem CID | 91365148 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-(2-acetamido-9-oxoacridin-10-yl)hexanoate |
| SMILES | CC(=O)Nc1ccc2c(c1)c(=O)c1ccccc1n2CCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C25H25N3O6/c1-16(29)26-17-10-11-21-19(15-17)25(33)18-7-4-5-8-20(18)27(21)14-6-2-3-9-24(32)34-28-22(30)12-13-23(28)31/h4-5,7-8,10-13,15,30-31H,2-3,6,9,14H2,1H3,(H,26,29) |
| InChIKey | IGKYWSPKJYBUKN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|