C19H26ClNO6 — CID 91365958
3-(4-chlorophenyl)-2-[formyl-[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]amino]butanoic acid (PubChem CID 91365958) has the molecular formula C19H26ClNO6 and a molecular weight of 399.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[formyl-[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]amino]butanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-[formyl-[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]amino]butanoic acid |
|---|---|
| PubChem CID | 91365958 |
| Molecular Formula | C19H26ClNO6 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[formyl-[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]amino]butanoic acid |
| SMILES | CC(C)C(=O)O[C@@H](ON(C=O)C(C(=O)O)C(C)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C19H26ClNO6/c1-11(2)18(25)26-19(12(3)4)27-21(10-22)16(17(23)24)13(5)14-6-8-15(20)9-7-14/h6-13,16,19H,1-5H3,(H,23,24)/t13?,16?,19-/m0/s1 |
| InChIKey | IRYNODYVQKOYEU-ZVYVSMAVSA-N |
| XLogP | 3.47 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|