C32H60N12 — CID 91368077
6,15,24,33-tetramethyl-2,6,11,15,20,24,29,33,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 91368077) has the molecular formula C32H60N12 and a molecular weight of 612.92 g/mol. Its IUPAC name is 6,15,24,33-tetramethyl-2,6,11,15,20,24,29,33,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 6,15,24,33-tetramethyl-2,6,11,15,20,24,29,33,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 91368077 |
| Molecular Formula | C32H60N12 |
| Molecular Weight | 612.92 g/mol |
| Exact Mass | 612.51 |
| IUPAC Name | 6,15,24,33-tetramethyl-2,6,11,15,20,24,29,33,37,38,39,40-dodecazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | CN1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CN(C)CCC63)C3CN(C)CCC53)C3CN(C)CCC43)C2C1 |
| InChI | InChI=1S/C32H60N12/c1-41-9-5-17-21(13-41)29-33-25(17)38-30-23-15-43(3)11-7-19(23)27(35-30)40-32-24-16-44(4)12-8-20(24)28(36-32)39-31-22-14-42(2)10-6-18(22)26(34-31)37-29/h17-40H,5-16H2,1-4H3 |
| InChIKey | PMOORCREASZOTP-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.92 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |