C26H31N5OS — CID 91368307
2-methyl-5-[3-[4-[2-(4-phenyl-1H-pyrazol-5-yl)ethyl]piperazin-1-yl]propoxy]-1,3-benzothiazole (PubChem CID 91368307) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is 2-methyl-5-[3-[4-[2-(4-phenyl-1H-pyrazol-5-yl)ethyl]piperazin-1-yl]propoxy]-1,3-benzothiazole.
| Compound Name | 2-methyl-5-[3-[4-[2-(4-phenyl-1H-pyrazol-5-yl)ethyl]piperazin-1-yl]propoxy]-1,3-benzothiazole |
|---|---|
| PubChem CID | 91368307 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-methyl-5-[3-[4-[2-(4-phenyl-1H-pyrazol-5-yl)ethyl]piperazin-1-yl]propoxy]-1,3-benzothiazole |
| SMILES | Cc1nc2cc(OCCCN3CCN(CCc4[nH]ncc4-c4ccccc4)CC3)ccc2s1 |
| InChI | InChI=1S/C26H31N5OS/c1-20-28-25-18-22(8-9-26(25)33-20)32-17-5-11-30-13-15-31(16-14-30)12-10-24-23(19-27-29-24)21-6-3-2-4-7-21/h2-4,6-9,18-19H,5,10-17H2,1H3,(H,27,29) |
| InChIKey | LKNRTIYWDHFECZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|