C22H26N8O2 — CID 91373227
N-[4-[11-[(ethenylamino)oxymethyl]-7,8-dimethyl-3,4,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]butyl]benzamide (PubChem CID 91373227) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[4-[11-[(ethenylamino)oxymethyl]-7,8-dimethyl-3,4,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]butyl]benzamide.
| Compound Name | N-[4-[11-[(ethenylamino)oxymethyl]-7,8-dimethyl-3,4,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]butyl]benzamide |
|---|---|
| PubChem CID | 91373227 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[4-[11-[(ethenylamino)oxymethyl]-7,8-dimethyl-3,4,5,6,10,12-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]butyl]benzamide |
| SMILES | C=CNOCc1nc2c(c(C)c(C)n3nnnc23)n1CCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N8O2/c1-4-24-32-14-18-25-19-20(15(2)16(3)30-21(19)26-27-28-30)29(18)13-9-8-12-23-22(31)17-10-6-5-7-11-17/h4-7,10-11,24H,1,8-9,12-14H2,2-3H3,(H,23,31) |
| InChIKey | BMTUSBPALWBUJZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|