C20H32N6O2 — CID 91464354
N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-2-methylpropanamide (PubChem CID 91464354) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-2-methylpropanamide.
| Compound Name | N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 91464354 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-2-methylpropanamide |
| SMILES | C=C(C)NOCc1nc2c(N)nc(C)c(C)c2n1CCCCNC(=O)C(C)C |
| InChI | InChI=1S/C20H32N6O2/c1-12(2)20(27)22-9-7-8-10-26-16(11-28-25-13(3)4)24-17-18(26)14(5)15(6)23-19(17)21/h12,25H,3,7-11H2,1-2,4-6H3,(H2,21,23)(H,22,27) |
| InChIKey | RKWRZQYVHMZECO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|