C21H35N5O3 — CID 58869074
tert-butyl N-[4-(4-amino-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl)butyl]-N-methoxycarbamate (PubChem CID 58869074) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[4-(4-amino-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl)butyl]-N-methoxycarbamate.
| Compound Name | tert-butyl N-[4-(4-amino-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl)butyl]-N-methoxycarbamate |
|---|---|
| PubChem CID | 58869074 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl N-[4-(4-amino-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl)butyl]-N-methoxycarbamate |
| SMILES | CCCc1nc2c(N)nc(C)c(C)c2n1CCCCN(OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35N5O3/c1-8-11-16-24-17-18(14(2)15(3)23-19(17)22)25(16)12-9-10-13-26(28-7)20(27)29-21(4,5)6/h8-13H2,1-7H3,(H2,22,23) |
| InChIKey | BIDDUFCYVZFOBE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|