C23H30N6O2 — CID 91239280
N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]benzamide (PubChem CID 91239280) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]benzamide.
| Compound Name | N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 91239280 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-[4-[4-amino-6,7-dimethyl-2-[(prop-1-en-2-ylamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]benzamide |
| SMILES | C=C(C)NOCc1nc2c(N)nc(C)c(C)c2n1CCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H30N6O2/c1-15(2)28-31-14-19-27-20-21(16(3)17(4)26-22(20)24)29(19)13-9-8-12-25-23(30)18-10-6-5-7-11-18/h5-7,10-11,28H,1,8-9,12-14H2,2-4H3,(H2,24,26)(H,25,30) |
| InChIKey | AEAXRSOHXRXTIZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|