C15H11NO3 — CID 91378137
2-(1,3-benzodioxol-5-yl)isoindol-1-ol (PubChem CID 91378137) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)isoindol-1-ol.
| Compound Name | 2-(1,3-benzodioxol-5-yl)isoindol-1-ol |
|---|---|
| PubChem CID | 91378137 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)isoindol-1-ol |
| SMILES | Oc1c2ccccc2cn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11NO3/c17-15-12-4-2-1-3-10(12)8-16(15)11-5-6-13-14(7-11)19-9-18-13/h1-8,17H,9H2 |
| InChIKey | LKGLCOPFIYHHHR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |