C25H26O4S — CID 91382865
2-(1,2-diphenylethenoxymethyl)-3-(4-methylphenyl)sulfonylpropan-1-ol (PubChem CID 91382865) has the molecular formula C25H26O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-(1,2-diphenylethenoxymethyl)-3-(4-methylphenyl)sulfonylpropan-1-ol.
| Compound Name | 2-(1,2-diphenylethenoxymethyl)-3-(4-methylphenyl)sulfonylpropan-1-ol |
|---|---|
| PubChem CID | 91382865 |
| Molecular Formula | C25H26O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-(1,2-diphenylethenoxymethyl)-3-(4-methylphenyl)sulfonylpropan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)CC(CO)COC(=Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26O4S/c1-20-12-14-24(15-13-20)30(27,28)19-22(17-26)18-29-25(23-10-6-3-7-11-23)16-21-8-4-2-5-9-21/h2-16,22,26H,17-19H2,1H3 |
| InChIKey | BDCLOMMVQIAQRS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|