C13H22S — CID 91383027
1-cyclohexa-1,5-dien-1-ylethyl-ethyl-propan-2-ylidene-λ4-sulfane (PubChem CID 91383027) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylethyl-ethyl-propan-2-ylidene-λ4-sulfane.
| Compound Name | 1-cyclohexa-1,5-dien-1-ylethyl-ethyl-propan-2-ylidene-λ4-sulfane |
|---|---|
| PubChem CID | 91383027 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylethyl-ethyl-propan-2-ylidene-λ4-sulfane |
| SMILES | CCS(=C(C)C)C(C)C1=CCCC=C1 |
| InChI | InChI=1S/C13H22S/c1-5-14(11(2)3)12(4)13-9-7-6-8-10-13/h7,9-10,12H,5-6,8H2,1-4H3 |
| InChIKey | YIIOJBIYLQPJAY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|