C15H23NS3 — CID 91385008
ethane;4-ethyl-4-phenyl-1,3-thiazolidine-2,5-dithione (PubChem CID 91385008) has the molecular formula C15H23NS3 and a molecular weight of 313.56 g/mol. Its IUPAC name is ethane;4-ethyl-4-phenyl-1,3-thiazolidine-2,5-dithione.
| Compound Name | ethane;4-ethyl-4-phenyl-1,3-thiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 91385008 |
| Molecular Formula | C15H23NS3 |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethane;4-ethyl-4-phenyl-1,3-thiazolidine-2,5-dithione |
| SMILES | CC.CC.CCC1(c2ccccc2)NC(=S)SC1=S |
| InChI | InChI=1S/C11H11NS3.2C2H6/c1-2-11(8-6-4-3-5-7-8)9(13)15-10(14)12-11;2*1-2/h3-7H,2H2,1H3,(H,12,14);2*1-2H3 |
| InChIKey | BUPYLEQPBQWSOT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|