C18H19F3O2 — CID 91398431
5-cyclohexyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 91398431) has the molecular formula C18H19F3O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 5-cyclohexyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-cyclohexyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91398431 |
| Molecular Formula | C18H19F3O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 5-cyclohexyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=C(c1ccc(C(F)(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H19F3O2/c19-18(20,21)15-11-9-14(10-12-15)16(7-4-8-17(22)23)13-5-2-1-3-6-13/h4,7-13H,1-3,5-6H2,(H,22,23) |
| InChIKey | GIBYYEDOOLVPAM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|