C26H44N2O — CID 91409486
2,2-bis(2-octylpyrrol-2-yl)ethanol (PubChem CID 91409486) has the molecular formula C26H44N2O and a molecular weight of 400.65 g/mol. Its IUPAC name is 2,2-bis(2-octylpyrrol-2-yl)ethanol.
| Compound Name | 2,2-bis(2-octylpyrrol-2-yl)ethanol |
|---|---|
| PubChem CID | 91409486 |
| Molecular Formula | C26H44N2O |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.35 |
| IUPAC Name | 2,2-bis(2-octylpyrrol-2-yl)ethanol |
| SMILES | CCCCCCCCC1(C(CO)C2(CCCCCCCC)C=CC=N2)C=CC=N1 |
| InChI | InChI=1S/C26H44N2O/c1-3-5-7-9-11-13-17-25(19-15-21-27-25)24(23-29)26(20-16-22-28-26)18-14-12-10-8-6-4-2/h15-16,19-22,24,29H,3-14,17-18,23H2,1-2H3 |
| InChIKey | BGXIUJWTAGJJDY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|