C32H35F5O6S — CID 91410273
4-[4-[2-hydroxy-1-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propoxy]phenyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol (PubChem CID 91410273) has the molecular formula C32H35F5O6S and a molecular weight of 642.68 g/mol. Its IUPAC name is 4-[4-[2-hydroxy-1-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propoxy]phenyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol.
| Compound Name | 4-[4-[2-hydroxy-1-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propoxy]phenyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 91410273 |
| Molecular Formula | C32H35F5O6S |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 4-[4-[2-hydroxy-1-[2-(4,4,5,5,5-pentafluoropentylsulfanyl)ethoxy]propoxy]phenyl]-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrochromen-7-ol |
| SMILES | CC(O)C(OCCSCCCC(F)(F)C(F)(F)F)Oc1ccc(C2c3ccc(O)cc3OCC2(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C32H35F5O6S/c1-20(38)29(41-15-17-44-16-3-14-31(33,34)32(35,36)37)43-25-11-4-21(5-12-25)28-26-13-10-24(40)18-27(26)42-19-30(28,2)22-6-8-23(39)9-7-22/h4-13,18,20,28-29,38-40H,3,14-17,19H2,1-2H3 |
| InChIKey | DLNAGOPYMXJAMN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|