About perylene
perylene (PubChem CID 9142) has the molecular formula C20H12
and a molecular weight of 252.32 g/mol. Its IUPAC name is perylene.
Molecular Properties
| Compound Name | perylene |
| PubChem CID | 9142 |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | perylene |
| SMILES | c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-12H |
| InChIKey | CSHWQDPOILHKBI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perylene?
The IUPAC name of perylene (CID 9142) is perylene.
What is the SMILES notation for perylene?
The canonical SMILES for perylene is c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of perylene?
The InChIKey is CSHWQDPOILHKBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-12H.
What are the key properties of perylene?
perylene has a molecular weight of 252.32 g/mol, XLogP of 5.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for perylene is sourced from PubChem (CID 9142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).