C21H28BrF2N3O3 — CID 91420278
tert-butyl 4-[[1-(4-bromo-2,5-difluorophenyl)-3,6-dihydro-2H-pyridin-4-yl]amino]oxypiperidine-1-carboxylate (PubChem CID 91420278) has the molecular formula C21H28BrF2N3O3 and a molecular weight of 488.37 g/mol. Its IUPAC name is tert-butyl 4-[[1-(4-bromo-2,5-difluorophenyl)-3,6-dihydro-2H-pyridin-4-yl]amino]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(4-bromo-2,5-difluorophenyl)-3,6-dihydro-2H-pyridin-4-yl]amino]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 91420278 |
| Molecular Formula | C21H28BrF2N3O3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | tert-butyl 4-[[1-(4-bromo-2,5-difluorophenyl)-3,6-dihydro-2H-pyridin-4-yl]amino]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(ONC2=CCN(c3cc(F)c(Br)cc3F)CC2)CC1 |
| InChI | InChI=1S/C21H28BrF2N3O3/c1-21(2,3)29-20(28)27-10-6-15(7-11-27)30-25-14-4-8-26(9-5-14)19-13-17(23)16(22)12-18(19)24/h4,12-13,15,25H,5-11H2,1-3H3 |
| InChIKey | ABFWMVXDXDOCJP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|