C22H34O9 — CID 91420623
[2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 91420623) has the molecular formula C22H34O9 and a molecular weight of 442.51 g/mol. Its IUPAC name is [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 91420623 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)OCC(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12)C(C)(C)C |
| InChI | InChI=1S/C22H34O9/c1-20(2,3)9-11(21(4,5)6)17(24)26-10-12(23)27-15-13-14(28-18(15)25)16-19(29-13)31-22(7,8)30-16/h11,13-16,19H,9-10H2,1-8H3 |
| InChIKey | HAVQURMDPRDENJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|