C11H14N2 — CID 91428917
3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-3-amine (PubChem CID 91428917) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-3-amine.
| Compound Name | 3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-3-amine |
|---|---|
| PubChem CID | 91428917 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3,3a,4,4a,8a,8b-hexahydrocyclopenta[b]indol-3-amine |
| SMILES | NC1C=CC2C3C=CC=CC3NC12 |
| InChI | InChI=1S/C11H14N2/c12-9-6-5-8-7-3-1-2-4-10(7)13-11(8)9/h1-11,13H,12H2 |
| InChIKey | QSPHZGAAPVMVMS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|