3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid

C14H8Cl2O5 — CID 91431228

IUPAC3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid
SMILESO=C(Oc1c(Cl)ccc(Cl)c1C(=O)O)c1ccccc1O
InChIInChI=1S/C14H8Cl2O5/c15-8-5-6-9(16)12(11(8)13(18)19)21-14(20)7-3-1-2-4-10(7)17/h1-6,17H,(H,18,19)
InChIKeyPKUPBUWBUIGUHB-UHFFFAOYSA-N
MW327.12 g/mol
LogP3.62
Rot. Bonds3

About 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid

3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid (PubChem CID 91431228) has the molecular formula C14H8Cl2O5 and a molecular weight of 327.12 g/mol. Its IUPAC name is 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid.

Molecular Properties

Compound Name3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid
PubChem CID91431228
Molecular FormulaC14H8Cl2O5
Molecular Weight327.12 g/mol
Exact Mass325.97
IUPAC Name3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid
SMILESO=C(Oc1c(Cl)ccc(Cl)c1C(=O)O)c1ccccc1O
InChIInChI=1S/C14H8Cl2O5/c15-8-5-6-9(16)12(11(8)13(18)19)21-14(20)7-3-1-2-4-10(7)17/h1-6,17H,(H,18,19)
InChIKeyPKUPBUWBUIGUHB-UHFFFAOYSA-N
XLogP3.62
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.12
LogP ≤ 53.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2,4,6-trichlorophenyl) 2-hydroxybenzoate
CID 23297410
6-chloro-3-hydroxy-2-methoxybenzoic acid
CID 117291132
formaldehyde;phenyl 2-hydroxybenzoate
CID 70193884
carbonic acid;3,6-dichloro-2-methoxybenzoic acid
CID 175112629
(3,5-dichlorophenyl) 2-hydroxybenzoate
CID 157309463
(2,4-dichlorophenyl) 2-hydroxybenzoate
CID 520433
bis(2,4,6-trichlorophenyl) benzene-1,2-dicarboxylate
CID 54423741
2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury
CID 174770539
benzene-1,4-diol;tris(2-hydroxybenzoic acid);phenyl 2-hydroxybenzoate
CID 161221289
3-chlorophthalic acid;phthalic acid
CID 174649164
2-hydroxybenzoic acid;hypochlorous acid
CID 68579561
(2,3,4,5,6-pentafluorophenyl) 2-chlorobenzoate
CID 71348420

Frequently Asked Questions

What is the IUPAC name of 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid?
The IUPAC name of 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid (CID 91431228) is 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid.
What is the SMILES notation for 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid?
The canonical SMILES for 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid is O=C(Oc1c(Cl)ccc(Cl)c1C(=O)O)c1ccccc1O.
What is the InChIKey of 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid?
The InChIKey is PKUPBUWBUIGUHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2O5/c15-8-5-6-9(16)12(11(8)13(18)19)21-14(20)7-3-1-2-4-10(7)17/h1-6,17H,(H,18,19).
What are the key properties of 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid?
3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid has a molecular weight of 327.12 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-2-(2-hydroxybenzoyl)oxybenzoic acid is sourced from PubChem (CID 91431228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).