C10H18N4O3 — CID 91431531
amino-[1-[5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,2,4-triazol-3-yl]methanol (PubChem CID 91431531) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is amino-[1-[5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,2,4-triazol-3-yl]methanol.
| Compound Name | amino-[1-[5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 91431531 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | amino-[1-[5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]-1,2,4-triazol-3-yl]methanol |
| SMILES | CC1C(CO)OC(n2cnc(C(N)O)n2)C1C |
| InChI | InChI=1S/C10H18N4O3/c1-5-6(2)10(17-7(5)3-15)14-4-12-9(13-14)8(11)16/h4-8,10,15-16H,3,11H2,1-2H3 |
| InChIKey | XXRJXSVICDWZRU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|