C8H13ClN2O2 — CID 91433435
2-[3-methyl-5-(methylamino)-1H-pyrrol-2-yl]acetic acid;hydrochloride (PubChem CID 91433435) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 2-[3-methyl-5-(methylamino)-1H-pyrrol-2-yl]acetic acid;hydrochloride.
| Compound Name | 2-[3-methyl-5-(methylamino)-1H-pyrrol-2-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 91433435 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-[3-methyl-5-(methylamino)-1H-pyrrol-2-yl]acetic acid;hydrochloride |
| SMILES | CNc1cc(C)c(CC(=O)O)[nH]1.Cl |
| InChI | InChI=1S/C8H12N2O2.ClH/c1-5-3-7(9-2)10-6(5)4-8(11)12;/h3,9-10H,4H2,1-2H3,(H,11,12);1H |
| InChIKey | CLRIGMZZZDXFKP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |