C7H11BrN2 — CID 21051491
5-(bromomethyl)-N,4-dimethyl-1H-pyrrol-2-amine (PubChem CID 21051491) has the molecular formula C7H11BrN2 and a molecular weight of 203.08 g/mol. Its IUPAC name is 5-(bromomethyl)-N,4-dimethyl-1H-pyrrol-2-amine.
| Compound Name | 5-(bromomethyl)-N,4-dimethyl-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 21051491 |
| Molecular Formula | C7H11BrN2 |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 5-(bromomethyl)-N,4-dimethyl-1H-pyrrol-2-amine |
| SMILES | CNc1cc(C)c(CBr)[nH]1 |
| InChI | InChI=1S/C7H11BrN2/c1-5-3-7(9-2)10-6(5)4-8/h3,9-10H,4H2,1-2H3 |
| InChIKey | ZCCUWAFZAIAUCZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|