C34H52N4O8 — CID 91450396
(3S,9S,12R,14S)-3-benzyl-6-ethyl-9-[7-(2-methoxyethoxymethoxy)-6-oxooctyl]-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 91450396) has the molecular formula C34H52N4O8 and a molecular weight of 644.81 g/mol. Its IUPAC name is (3S,9S,12R,14S)-3-benzyl-6-ethyl-9-[7-(2-methoxyethoxymethoxy)-6-oxooctyl]-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,9S,12R,14S)-3-benzyl-6-ethyl-9-[7-(2-methoxyethoxymethoxy)-6-oxooctyl]-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 91450396 |
| Molecular Formula | C34H52N4O8 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | (3S,9S,12R,14S)-3-benzyl-6-ethyl-9-[7-(2-methoxyethoxymethoxy)-6-oxooctyl]-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CCC1(C)NC(=O)[C@H](CCCCCC(=O)C(C)OCOCCOC)NC(=O)[C@H]2C[C@H](C)CN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C34H52N4O8/c1-6-34(4)33(43)36-27(20-25-13-9-7-10-14-25)32(42)38-21-23(2)19-28(38)31(41)35-26(30(40)37-34)15-11-8-12-16-29(39)24(3)46-22-45-18-17-44-5/h7,9-10,13-14,23-24,26-28H,6,8,11-12,15-22H2,1-5H3,(H,35,41)(H,36,43)(H,37,40)/t23-,24?,26-,27-,28+,34?/m0/s1 |
| InChIKey | PZLJLDIDMFSGHD-GLAOLRTISA-N |
| XLogP | 2.28 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|