C30H44N4O5 — CID 58725972
(3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58725972) has the molecular formula C30H44N4O5 and a molecular weight of 540.71 g/mol. Its IUPAC name is (3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58725972 |
| Molecular Formula | C30H44N4O5 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | (3S,6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2C[C@H](C)CN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@](C)(CC)NC1=O |
| InChI | InChI=1S/C30H44N4O5/c1-5-22(35)15-11-8-12-16-23-26(36)33-30(4,6-2)29(39)32-24(18-21-13-9-7-10-14-21)28(38)34-19-20(3)17-25(34)27(37)31-23/h7,9-10,13-14,20,23-25H,5-6,8,11-12,15-19H2,1-4H3,(H,31,37)(H,32,39)(H,33,36)/t20-,23-,24-,25+,30-/m0/s1 |
| InChIKey | LJOYXODNMDVBGK-WGJOIAILSA-N |
| XLogP | 2.66 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|