C29H42N4O6 — CID 162897421
3-benzyl-9-(7-hydroxy-6-oxooctyl)-6,6,14-trimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 162897421) has the molecular formula C29H42N4O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is 3-benzyl-9-(7-hydroxy-6-oxooctyl)-6,6,14-trimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | 3-benzyl-9-(7-hydroxy-6-oxooctyl)-6,6,14-trimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 162897421 |
| Molecular Formula | C29H42N4O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 3-benzyl-9-(7-hydroxy-6-oxooctyl)-6,6,14-trimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC1CC2C(=O)NC(CCCCCC(=O)C(C)O)C(=O)NC(C)(C)C(=O)NC(Cc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C29H42N4O6/c1-18-15-23-26(37)30-21(13-9-6-10-14-24(35)19(2)34)25(36)32-29(3,4)28(39)31-22(27(38)33(23)17-18)16-20-11-7-5-8-12-20/h5,7-8,11-12,18-19,21-23,34H,6,9-10,13-17H2,1-4H3,(H,30,37)(H,31,39)(H,32,36) |
| InChIKey | KQHHRCHZFQIKDS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|