C17H18N2O7S — CID 91456061
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[2-(4-methylphenyl)sulfonylethenyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 91456061) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[2-(4-methylphenyl)sulfonylethenyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[2-(4-methylphenyl)sulfonylethenyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91456061 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[2-(4-methylphenyl)sulfonylethenyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)C=C[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H18N2O7S/c1-10-2-4-11(5-3-10)27(24,25)9-7-12-14(21)15(22)16(26-12)19-8-6-13(20)18-17(19)23/h2-9,12,14-16,21-22H,1H3,(H,18,20,23)/t12-,14-,15-,16-/m1/s1 |
| InChIKey | AIYYBMFCPZLUSO-DTZQCDIJSA-N |
| XLogP | -0.55 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |