C15H18N2O7 — CID 6476946
ethyl (2Z,4E)-5-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]penta-2,4-dienoate (PubChem CID 6476946) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]penta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 6476946 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | ethyl (2Z,4E)-5-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C\C=C\[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H18N2O7/c1-2-23-11(19)6-4-3-5-9-12(20)13(21)14(24-9)17-8-7-10(18)16-15(17)22/h3-9,12-14,20-21H,2H2,1H3,(H,16,18,22)/b5-3+,6-4-/t9-,12-,13-,14-/m1/s1 |
| InChIKey | ZDGCOGWHPYEZPE-ORYBJIMLSA-N |
| XLogP | -1.17 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|