C14H21N2O6S+ — CID 91461371
2-aminoethyl-bis(carboxymethyl)-(2,5-dimethylphenyl)sulfonylazanium (PubChem CID 91461371) has the molecular formula C14H21N2O6S+ and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-aminoethyl-bis(carboxymethyl)-(2,5-dimethylphenyl)sulfonylazanium.
| Compound Name | 2-aminoethyl-bis(carboxymethyl)-(2,5-dimethylphenyl)sulfonylazanium |
|---|---|
| PubChem CID | 91461371 |
| Molecular Formula | C14H21N2O6S+ |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-aminoethyl-bis(carboxymethyl)-(2,5-dimethylphenyl)sulfonylazanium |
| SMILES | Cc1ccc(C)c(S(=O)(=O)[N+](CCN)(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C14H20N2O6S/c1-10-3-4-11(2)12(7-10)23(21,22)16(6-5-15,8-13(17)18)9-14(19)20/h3-4,7H,5-6,8-9,15H2,1-2H3,(H-,17,18,19,20)/p+1 |
| InChIKey | ITOJIHPDPKHUTK-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|