About 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane
6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane (PubChem CID 91462782) has the molecular formula C9H12ClN3
and a molecular weight of 197.67 g/mol. Its IUPAC name is 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane.
Molecular Properties
| Compound Name | 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane |
| PubChem CID | 91462782 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane |
| SMILES | CC.ClCc1ccc2nccn2n1 |
| InChI | InChI=1S/C7H6ClN3.C2H6/c8-5-6-1-2-7-9-3-4-11(7)10-6;1-2/h1-4H,5H2;1-2H3 |
| InChIKey | XWLXGQKOIQEIMU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane?
The IUPAC name of 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane (CID 91462782) is 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane.
What is the SMILES notation for 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane?
The canonical SMILES for 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane is CC.ClCc1ccc2nccn2n1.
What is the InChIKey of 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane?
The InChIKey is XWLXGQKOIQEIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3.C2H6/c8-5-6-1-2-7-9-3-4-11(7)10-6;1-2/h1-4H,5H2;1-2H3.
What are the key properties of 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane?
6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane has a molecular weight of 197.67 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)imidazo[1,2-b]pyridazine;ethane is sourced from PubChem (CID 91462782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).