About 6-propylimidazo[1,2-b]pyridazine
6-propylimidazo[1,2-b]pyridazine (PubChem CID 67266395) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 6-propylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-propylimidazo[1,2-b]pyridazine |
| PubChem CID | 67266395 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 6-propylimidazo[1,2-b]pyridazine |
| SMILES | CCCc1ccc2nccn2n1 |
| InChI | InChI=1S/C9H11N3/c1-2-3-8-4-5-9-10-6-7-12(9)11-8/h4-7H,2-3H2,1H3 |
| InChIKey | HXKXKLXPIYPJMI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propylimidazo[1,2-b]pyridazine?
The IUPAC name of 6-propylimidazo[1,2-b]pyridazine (CID 67266395) is 6-propylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-propylimidazo[1,2-b]pyridazine?
The canonical SMILES for 6-propylimidazo[1,2-b]pyridazine is CCCc1ccc2nccn2n1.
What is the InChIKey of 6-propylimidazo[1,2-b]pyridazine?
The InChIKey is HXKXKLXPIYPJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-2-3-8-4-5-9-10-6-7-12(9)11-8/h4-7H,2-3H2,1H3.
What are the key properties of 6-propylimidazo[1,2-b]pyridazine?
6-propylimidazo[1,2-b]pyridazine has a molecular weight of 161.21 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 67266395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).