C13H18Br2O3 — CID 91468170
1,5-dibromo-2,4-dimethoxy-3-pentoxybenzene (PubChem CID 91468170) has the molecular formula C13H18Br2O3 and a molecular weight of 382.09 g/mol. Its IUPAC name is 1,5-dibromo-2,4-dimethoxy-3-pentoxybenzene.
| Compound Name | 1,5-dibromo-2,4-dimethoxy-3-pentoxybenzene |
|---|---|
| PubChem CID | 91468170 |
| Molecular Formula | C13H18Br2O3 |
| Molecular Weight | 382.09 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 1,5-dibromo-2,4-dimethoxy-3-pentoxybenzene |
| SMILES | CCCCCOc1c(OC)c(Br)cc(Br)c1OC |
| InChI | InChI=1S/C13H18Br2O3/c1-4-5-6-7-18-13-11(16-2)9(14)8-10(15)12(13)17-3/h8H,4-7H2,1-3H3 |
| InChIKey | RJXCFPDOYZWTBY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.09 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|